C15H14N2O2S — CID 125483735
6-phenyl-3-(1,3-thiazolidine-3-carbonyl)-1H-pyridin-2-one (PubChem CID 125483735) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 6-phenyl-3-(1,3-thiazolidine-3-carbonyl)-1H-pyridin-2-one.
| Compound Name | 6-phenyl-3-(1,3-thiazolidine-3-carbonyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 125483735 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 6-phenyl-3-(1,3-thiazolidine-3-carbonyl)-1H-pyridin-2-one |
| SMILES | O=C(c1ccc(-c2ccccc2)[nH]c1=O)N1CCSC1 |
| InChI | InChI=1S/C15H14N2O2S/c18-14-12(15(19)17-8-9-20-10-17)6-7-13(16-14)11-4-2-1-3-5-11/h1-7H,8-10H2,(H,16,18) |
| InChIKey | IEGDEORWJUICJI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |