C22H21N3O2 — CID 72857453
3-[(3R,4S)-3-amino-4-phenylpyrrolidine-1-carbonyl]-6-phenyl-1H-pyridin-2-one (PubChem CID 72857453) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-[(3R,4S)-3-amino-4-phenylpyrrolidine-1-carbonyl]-6-phenyl-1H-pyridin-2-one.
| Compound Name | 3-[(3R,4S)-3-amino-4-phenylpyrrolidine-1-carbonyl]-6-phenyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 72857453 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 3-[(3R,4S)-3-amino-4-phenylpyrrolidine-1-carbonyl]-6-phenyl-1H-pyridin-2-one |
| SMILES | N[C@H]1CN(C(=O)c2ccc(-c3ccccc3)[nH]c2=O)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H21N3O2/c23-19-14-25(13-18(19)15-7-3-1-4-8-15)22(27)17-11-12-20(24-21(17)26)16-9-5-2-6-10-16/h1-12,18-19H,13-14,23H2,(H,24,26)/t18-,19+/m1/s1 |
| InChIKey | WZYONJDSIVXPMN-MOPGFXCFSA-N |
| XLogP | 2.61 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |