C15H12ClNO — CID 110472967
(2-chlorophenyl)-(1,3-dihydroisoindol-2-yl)methanone (PubChem CID 110472967) has the molecular formula C15H12ClNO and a molecular weight of 257.72 g/mol. Its IUPAC name is (2-chlorophenyl)-(1,3-dihydroisoindol-2-yl)methanone.
| Compound Name | (2-chlorophenyl)-(1,3-dihydroisoindol-2-yl)methanone |
|---|---|
| PubChem CID | 110472967 |
| Molecular Formula | C15H12ClNO |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | (2-chlorophenyl)-(1,3-dihydroisoindol-2-yl)methanone |
| SMILES | O=C(c1ccccc1Cl)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H12ClNO/c16-14-8-4-3-7-13(14)15(18)17-9-11-5-1-2-6-12(11)10-17/h1-8H,9-10H2 |
| InChIKey | GEQWWOMBEJDLJQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |