C21H16Cl2N2O3 — CID 86294738
[5-(2,4-dichloroanilino)-2,4-dihydroxyphenyl]-(1,3-dihydroisoindol-2-yl)methanone (PubChem CID 86294738) has the molecular formula C21H16Cl2N2O3 and a molecular weight of 415.28 g/mol. Its IUPAC name is [5-(2,4-dichloroanilino)-2,4-dihydroxyphenyl]-(1,3-dihydroisoindol-2-yl)methanone.
| Compound Name | [5-(2,4-dichloroanilino)-2,4-dihydroxyphenyl]-(1,3-dihydroisoindol-2-yl)methanone |
|---|---|
| PubChem CID | 86294738 |
| Molecular Formula | C21H16Cl2N2O3 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | [5-(2,4-dichloroanilino)-2,4-dihydroxyphenyl]-(1,3-dihydroisoindol-2-yl)methanone |
| SMILES | O=C(c1cc(Nc2ccc(Cl)cc2Cl)c(O)cc1O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C21H16Cl2N2O3/c22-14-5-6-17(16(23)7-14)24-18-8-15(19(26)9-20(18)27)21(28)25-10-12-3-1-2-4-13(12)11-25/h1-9,24,26-27H,10-11H2 |
| InChIKey | RDTXDLNNGRSXJZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|