C20H20Cl2N2O2 — CID 108964026
N-(2,4-dichlorophenyl)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2,2-dimethyl-3-oxopropanamide (PubChem CID 108964026) has the molecular formula C20H20Cl2N2O2 and a molecular weight of 391.30 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2,2-dimethyl-3-oxopropanamide.
| Compound Name | N-(2,4-dichlorophenyl)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2,2-dimethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 108964026 |
| Molecular Formula | C20H20Cl2N2O2 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | N-(2,4-dichlorophenyl)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2,2-dimethyl-3-oxopropanamide |
| SMILES | CC(C)(C(=O)Nc1ccc(Cl)cc1Cl)C(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H20Cl2N2O2/c1-20(2,18(25)23-17-8-7-15(21)11-16(17)22)19(26)24-10-9-13-5-3-4-6-14(13)12-24/h3-8,11H,9-10,12H2,1-2H3,(H,23,25) |
| InChIKey | NPVVFNMTHKHMAQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|