C23H23N3O2 — CID 108964021
3-(3,4-dihydro-1H-isoquinolin-2-yl)-2,2-dimethyl-3-oxo-N-quinolin-8-ylpropanamide (PubChem CID 108964021) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 3-(3,4-dihydro-1H-isoquinolin-2-yl)-2,2-dimethyl-3-oxo-N-quinolin-8-ylpropanamide.
| Compound Name | 3-(3,4-dihydro-1H-isoquinolin-2-yl)-2,2-dimethyl-3-oxo-N-quinolin-8-ylpropanamide |
|---|---|
| PubChem CID | 108964021 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 3-(3,4-dihydro-1H-isoquinolin-2-yl)-2,2-dimethyl-3-oxo-N-quinolin-8-ylpropanamide |
| SMILES | CC(C)(C(=O)Nc1cccc2cccnc12)C(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C23H23N3O2/c1-23(2,22(28)26-14-12-16-7-3-4-8-18(16)15-26)21(27)25-19-11-5-9-17-10-6-13-24-20(17)19/h3-11,13H,12,14-15H2,1-2H3,(H,25,27) |
| InChIKey | BZWONEJAWGJDIR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|