2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen

C14H18N2O — CID 143593011

IUPAC2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen
SMILESCC(C)(C)C(=O)Nc1cccc2cccnc12.[H][H]
InChIInChI=1S/C14H16N2O.H2/c1-14(2,3)13(17)16-11-8-4-6-10-7-5-9-15-12(10)11;/h4-9H,1-3H3,(H,16,17);1H
InChIKeyIJTZQDYDXARTLX-UHFFFAOYSA-N
MW230.31 g/mol
LogP3.47
Rot. Bonds1

About 2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen

2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen (PubChem CID 143593011) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen.

Molecular Properties

Compound Name2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen
PubChem CID143593011
Molecular FormulaC14H18N2O
Molecular Weight230.31 g/mol
Exact Mass230.14
IUPAC Name2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen
SMILESCC(C)(C)C(=O)Nc1cccc2cccnc12.[H][H]
InChIInChI=1S/C14H16N2O.H2/c1-14(2,3)13(17)16-11-8-4-6-10-7-5-9-15-12(10)11;/h4-9H,1-3H3,(H,16,17);1H
InChIKeyIJTZQDYDXARTLX-UHFFFAOYSA-N
XLogP3.47
TPSA41.99 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.31
LogP ≤ 53.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen?
The IUPAC name of 2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen (CID 143593011) is 2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen.
What is the SMILES notation for 2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen?
The canonical SMILES for 2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen is CC(C)(C)C(=O)Nc1cccc2cccnc12.[H][H].
What is the InChIKey of 2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen?
The InChIKey is IJTZQDYDXARTLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O.H2/c1-14(2,3)13(17)16-11-8-4-6-10-7-5-9-15-12(10)11;/h4-9H,1-3H3,(H,16,17);1H.
What are the key properties of 2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen?
2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen has a molecular weight of 230.31 g/mol, XLogP of 3.47, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen is sourced from PubChem (CID 143593011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).