C14H18N2O — CID 143593011
2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen (PubChem CID 143593011) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen.
| Compound Name | 2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen |
|---|---|
| PubChem CID | 143593011 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 2,2-dimethyl-N-quinolin-8-ylpropanamide;molecular hydrogen |
| SMILES | CC(C)(C)C(=O)Nc1cccc2cccnc12.[H][H] |
| InChI | InChI=1S/C14H16N2O.H2/c1-14(2,3)13(17)16-11-8-4-6-10-7-5-9-15-12(10)11;/h4-9H,1-3H3,(H,16,17);1H |
| InChIKey | IJTZQDYDXARTLX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |