C16H19N3O2 — CID 17424107
2,2-dimethyl-N-[2-oxo-2-(quinolin-8-ylamino)ethyl]propanamide (PubChem CID 17424107) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-oxo-2-(quinolin-8-ylamino)ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-oxo-2-(quinolin-8-ylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 17424107 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2,2-dimethyl-N-[2-oxo-2-(quinolin-8-ylamino)ethyl]propanamide |
| SMILES | CC(C)(C)C(=O)NCC(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C16H19N3O2/c1-16(2,3)15(21)18-10-13(20)19-12-8-4-6-11-7-5-9-17-14(11)12/h4-9H,10H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | HDSYVFIQQJBFPU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |