C16H22Cl2N4O2 — CID 120565209
4-amino-N-[2-oxo-2-(quinolin-8-ylamino)ethyl]pentanamide;dihydrochloride (PubChem CID 120565209) has the molecular formula C16H22Cl2N4O2 and a molecular weight of 373.28 g/mol. Its IUPAC name is 4-amino-N-[2-oxo-2-(quinolin-8-ylamino)ethyl]pentanamide;dihydrochloride.
| Compound Name | 4-amino-N-[2-oxo-2-(quinolin-8-ylamino)ethyl]pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 120565209 |
| Molecular Formula | C16H22Cl2N4O2 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 4-amino-N-[2-oxo-2-(quinolin-8-ylamino)ethyl]pentanamide;dihydrochloride |
| SMILES | CC(N)CCC(=O)NCC(=O)Nc1cccc2cccnc12.Cl.Cl |
| InChI | InChI=1S/C16H20N4O2.2ClH/c1-11(17)7-8-14(21)19-10-15(22)20-13-6-2-4-12-5-3-9-18-16(12)13;;/h2-6,9,11H,7-8,10,17H2,1H3,(H,19,21)(H,20,22);2*1H |
| InChIKey | PLVGMLYCZZUUEJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |