C23H28N2OSi — CID 163364489
5-[dimethyl(phenyl)silyl]-4-methyl-N-quinolin-8-ylpentanamide (PubChem CID 163364489) has the molecular formula C23H28N2OSi and a molecular weight of 376.58 g/mol. Its IUPAC name is 5-[dimethyl(phenyl)silyl]-4-methyl-N-quinolin-8-ylpentanamide.
| Compound Name | 5-[dimethyl(phenyl)silyl]-4-methyl-N-quinolin-8-ylpentanamide |
|---|---|
| PubChem CID | 163364489 |
| Molecular Formula | C23H28N2OSi |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 5-[dimethyl(phenyl)silyl]-4-methyl-N-quinolin-8-ylpentanamide |
| SMILES | CC(CCC(=O)Nc1cccc2cccnc12)C[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H28N2OSi/c1-18(17-27(2,3)20-11-5-4-6-12-20)14-15-22(26)25-21-13-7-9-19-10-8-16-24-23(19)21/h4-13,16,18H,14-15,17H2,1-3H3,(H,25,26) |
| InChIKey | ALNNCOKKRPRHGR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|