C29H31BrN2OSi — CID 163364514
5-(4-bromophenyl)-3-[[dimethyl(phenyl)silyl]methyl]-N-quinolin-8-ylpentanamide (PubChem CID 163364514) has the molecular formula C29H31BrN2OSi and a molecular weight of 531.57 g/mol. Its IUPAC name is 5-(4-bromophenyl)-3-[[dimethyl(phenyl)silyl]methyl]-N-quinolin-8-ylpentanamide.
| Compound Name | 5-(4-bromophenyl)-3-[[dimethyl(phenyl)silyl]methyl]-N-quinolin-8-ylpentanamide |
|---|---|
| PubChem CID | 163364514 |
| Molecular Formula | C29H31BrN2OSi |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 5-(4-bromophenyl)-3-[[dimethyl(phenyl)silyl]methyl]-N-quinolin-8-ylpentanamide |
| SMILES | C[Si](C)(CC(CCc1ccc(Br)cc1)CC(=O)Nc1cccc2cccnc12)c1ccccc1 |
| InChI | InChI=1S/C29H31BrN2OSi/c1-34(2,26-10-4-3-5-11-26)21-23(14-13-22-15-17-25(30)18-16-22)20-28(33)32-27-12-6-8-24-9-7-19-31-29(24)27/h3-12,15-19,23H,13-14,20-21H2,1-2H3,(H,32,33) |
| InChIKey | MJFJAQRJMDEAMV-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|