C25H32N2OSi — CID 163364527
6-phenyl-N-quinolin-8-yl-3-(trimethylsilylmethyl)hexanamide (PubChem CID 163364527) has the molecular formula C25H32N2OSi and a molecular weight of 404.63 g/mol. Its IUPAC name is 6-phenyl-N-quinolin-8-yl-3-(trimethylsilylmethyl)hexanamide.
| Compound Name | 6-phenyl-N-quinolin-8-yl-3-(trimethylsilylmethyl)hexanamide |
|---|---|
| PubChem CID | 163364527 |
| Molecular Formula | C25H32N2OSi |
| Molecular Weight | 404.63 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 6-phenyl-N-quinolin-8-yl-3-(trimethylsilylmethyl)hexanamide |
| SMILES | C[Si](C)(C)CC(CCCc1ccccc1)CC(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C25H32N2OSi/c1-29(2,3)19-21(13-7-12-20-10-5-4-6-11-20)18-24(28)27-23-16-8-14-22-15-9-17-26-25(22)23/h4-6,8-11,14-17,21H,7,12-13,18-19H2,1-3H3,(H,27,28) |
| InChIKey | RCLQWIDSBXSDLU-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.63 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|