C22H24N2O — CID 132571622
2,2-dimethyl-5-phenyl-N-quinolin-8-ylpentanamide (PubChem CID 132571622) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is 2,2-dimethyl-5-phenyl-N-quinolin-8-ylpentanamide.
| Compound Name | 2,2-dimethyl-5-phenyl-N-quinolin-8-ylpentanamide |
|---|---|
| PubChem CID | 132571622 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 2,2-dimethyl-5-phenyl-N-quinolin-8-ylpentanamide |
| SMILES | CC(C)(CCCc1ccccc1)C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C22H24N2O/c1-22(2,15-7-11-17-9-4-3-5-10-17)21(25)24-19-14-6-12-18-13-8-16-23-20(18)19/h3-6,8-10,12-14,16H,7,11,15H2,1-2H3,(H,24,25) |
| InChIKey | JYDAZZWPXLPQMN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |