C25H30N4O2 — CID 10093491
2,2-dibutyl-N-pyridin-2-yl-N'-quinolin-8-ylpropanediamide (PubChem CID 10093491) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2,2-dibutyl-N-pyridin-2-yl-N'-quinolin-8-ylpropanediamide.
| Compound Name | 2,2-dibutyl-N-pyridin-2-yl-N'-quinolin-8-ylpropanediamide |
|---|---|
| PubChem CID | 10093491 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 2,2-dibutyl-N-pyridin-2-yl-N'-quinolin-8-ylpropanediamide |
| SMILES | CCCCC(CCCC)(C(=O)Nc1ccccn1)C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C25H30N4O2/c1-3-5-15-25(16-6-4-2,24(31)29-21-14-7-8-17-26-21)23(30)28-20-13-9-11-19-12-10-18-27-22(19)20/h7-14,17-18H,3-6,15-16H2,1-2H3,(H,28,30)(H,26,29,31) |
| InChIKey | SACUDKRJZIPSFE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|