C23H26N2O — CID 102129340
2-methyl-2-phenyl-N-quinolin-8-ylheptanamide (PubChem CID 102129340) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-methyl-2-phenyl-N-quinolin-8-ylheptanamide.
| Compound Name | 2-methyl-2-phenyl-N-quinolin-8-ylheptanamide |
|---|---|
| PubChem CID | 102129340 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-methyl-2-phenyl-N-quinolin-8-ylheptanamide |
| SMILES | CCCCCC(C)(C(=O)Nc1cccc2cccnc12)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O/c1-3-4-8-16-23(2,19-13-6-5-7-14-19)22(26)25-20-15-9-11-18-12-10-17-24-21(18)20/h5-7,9-15,17H,3-4,8,16H2,1-2H3,(H,25,26) |
| InChIKey | CVSZSPDVPHMTHB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|