C17H22N2O — CID 132522019
2-ethyl-2,3-dimethyl-N-quinolin-8-ylbutanamide (PubChem CID 132522019) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-ethyl-2,3-dimethyl-N-quinolin-8-ylbutanamide.
| Compound Name | 2-ethyl-2,3-dimethyl-N-quinolin-8-ylbutanamide |
|---|---|
| PubChem CID | 132522019 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 2-ethyl-2,3-dimethyl-N-quinolin-8-ylbutanamide |
| SMILES | CCC(C)(C(=O)Nc1cccc2cccnc12)C(C)C |
| InChI | InChI=1S/C17H22N2O/c1-5-17(4,12(2)3)16(20)19-14-10-6-8-13-9-7-11-18-15(13)14/h6-12H,5H2,1-4H3,(H,19,20) |
| InChIKey | SFVGTIACZQVQHN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |