C15H17N3O2 — CID 47225581
N-(2-methylpropyl)-N'-quinolin-8-yloxamide (PubChem CID 47225581) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-(2-methylpropyl)-N'-quinolin-8-yloxamide.
| Compound Name | N-(2-methylpropyl)-N'-quinolin-8-yloxamide |
|---|---|
| PubChem CID | 47225581 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | N-(2-methylpropyl)-N'-quinolin-8-yloxamide |
| SMILES | CC(C)CNC(=O)C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C15H17N3O2/c1-10(2)9-17-14(19)15(20)18-12-7-3-5-11-6-4-8-16-13(11)12/h3-8,10H,9H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | YDYCWGWVSZWLAW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|