C18H19N5O — CID 109273088
5-(2-methylpropylamino)-N-quinolin-8-ylpyrazine-2-carboxamide (PubChem CID 109273088) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 5-(2-methylpropylamino)-N-quinolin-8-ylpyrazine-2-carboxamide.
| Compound Name | 5-(2-methylpropylamino)-N-quinolin-8-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109273088 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 5-(2-methylpropylamino)-N-quinolin-8-ylpyrazine-2-carboxamide |
| SMILES | CC(C)CNc1cnc(C(=O)Nc2cccc3cccnc23)cn1 |
| InChI | InChI=1S/C18H19N5O/c1-12(2)9-21-16-11-20-15(10-22-16)18(24)23-14-7-3-5-13-6-4-8-19-17(13)14/h3-8,10-12H,9H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | UZPWXWCUBBJVAR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |