C20H19N3O4 — CID 51116996
N-(2-hydroxy-3-phenoxypropyl)-N'-quinolin-8-yloxamide (PubChem CID 51116996) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-(2-hydroxy-3-phenoxypropyl)-N'-quinolin-8-yloxamide.
| Compound Name | N-(2-hydroxy-3-phenoxypropyl)-N'-quinolin-8-yloxamide |
|---|---|
| PubChem CID | 51116996 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-(2-hydroxy-3-phenoxypropyl)-N'-quinolin-8-yloxamide |
| SMILES | O=C(NCC(O)COc1ccccc1)C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C20H19N3O4/c24-15(13-27-16-8-2-1-3-9-16)12-22-19(25)20(26)23-17-10-4-6-14-7-5-11-21-18(14)17/h1-11,15,24H,12-13H2,(H,22,25)(H,23,26) |
| InChIKey | YFNBXXFIDOHVKE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|