C19H17N3O3 — CID 108508241
N-[(4-methoxyphenyl)methyl]-N'-quinolin-8-yloxamide (PubChem CID 108508241) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-N'-quinolin-8-yloxamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-N'-quinolin-8-yloxamide |
|---|---|
| PubChem CID | 108508241 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-N'-quinolin-8-yloxamide |
| SMILES | COc1ccc(CNC(=O)C(=O)Nc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C19H17N3O3/c1-25-15-9-7-13(8-10-15)12-21-18(23)19(24)22-16-6-2-4-14-5-3-11-20-17(14)16/h2-11H,12H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | RVRQDBLBMQXVMZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|