C25H36N2OSi — CID 132918884
2,2-dimethyl-N-quinolin-8-yl-5-tri(propan-2-yl)silylpent-4-ynamide (PubChem CID 132918884) has the molecular formula C25H36N2OSi and a molecular weight of 408.66 g/mol. Its IUPAC name is 2,2-dimethyl-N-quinolin-8-yl-5-tri(propan-2-yl)silylpent-4-ynamide.
| Compound Name | 2,2-dimethyl-N-quinolin-8-yl-5-tri(propan-2-yl)silylpent-4-ynamide |
|---|---|
| PubChem CID | 132918884 |
| Molecular Formula | C25H36N2OSi |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 2,2-dimethyl-N-quinolin-8-yl-5-tri(propan-2-yl)silylpent-4-ynamide |
| SMILES | CC(C)[Si](C#CCC(C)(C)C(=O)Nc1cccc2cccnc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H36N2OSi/c1-18(2)29(19(3)4,20(5)6)17-11-15-25(7,8)24(28)27-22-14-9-12-21-13-10-16-26-23(21)22/h9-10,12-14,16,18-20H,15H2,1-8H3,(H,27,28) |
| InChIKey | DHXHUVTZBPUCLZ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|