C24H27F3N2OSi — CID 163364486
3-[[dimethyl(phenyl)silyl]methyl]-6,6,6-trifluoro-N-quinolin-8-ylhexanamide (PubChem CID 163364486) has the molecular formula C24H27F3N2OSi and a molecular weight of 444.57 g/mol. Its IUPAC name is 3-[[dimethyl(phenyl)silyl]methyl]-6,6,6-trifluoro-N-quinolin-8-ylhexanamide.
| Compound Name | 3-[[dimethyl(phenyl)silyl]methyl]-6,6,6-trifluoro-N-quinolin-8-ylhexanamide |
|---|---|
| PubChem CID | 163364486 |
| Molecular Formula | C24H27F3N2OSi |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 3-[[dimethyl(phenyl)silyl]methyl]-6,6,6-trifluoro-N-quinolin-8-ylhexanamide |
| SMILES | C[Si](C)(CC(CCC(F)(F)F)CC(=O)Nc1cccc2cccnc12)c1ccccc1 |
| InChI | InChI=1S/C24H27F3N2OSi/c1-31(2,20-10-4-3-5-11-20)17-18(13-14-24(25,26)27)16-22(30)29-21-12-6-8-19-9-7-15-28-23(19)21/h3-12,15,18H,13-14,16-17H2,1-2H3,(H,29,30) |
| InChIKey | VLMSTYLFSVCSJY-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|