C16H18Cl3N3O — CID 1132301
2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-(quinolin-8-ylamino)ethyl]propanamide (PubChem CID 1132301) has the molecular formula C16H18Cl3N3O and a molecular weight of 374.70 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-(quinolin-8-ylamino)ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-(quinolin-8-ylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 1132301 |
| Molecular Formula | C16H18Cl3N3O |
| Molecular Weight | 374.70 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-(quinolin-8-ylamino)ethyl]propanamide |
| SMILES | CC(C)(C)C(=O)N[C@@H](Nc1cccc2cccnc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H18Cl3N3O/c1-15(2,3)14(23)22-13(16(17,18)19)21-11-8-4-6-10-7-5-9-20-12(10)11/h4-9,13,21H,1-3H3,(H,22,23)/t13-/m1/s1 |
| InChIKey | WVXWVLDNRMVICQ-CYBMUJFWSA-N |
| XLogP | 4.51 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.70 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|