C15H16Cl3N3O — CID 2830547
N-[2,2,2-trichloro-1-(quinolin-8-ylamino)ethyl]butanamide (PubChem CID 2830547) has the molecular formula C15H16Cl3N3O and a molecular weight of 360.67 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-(quinolin-8-ylamino)ethyl]butanamide.
| Compound Name | N-[2,2,2-trichloro-1-(quinolin-8-ylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 2830547 |
| Molecular Formula | C15H16Cl3N3O |
| Molecular Weight | 360.67 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | N-[2,2,2-trichloro-1-(quinolin-8-ylamino)ethyl]butanamide |
| SMILES | CCCC(=O)NC(Nc1cccc2cccnc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H16Cl3N3O/c1-2-5-12(22)21-14(15(16,17)18)20-11-8-3-6-10-7-4-9-19-13(10)11/h3-4,6-9,14,20H,2,5H2,1H3,(H,21,22) |
| InChIKey | QVTRKFXYKYFJAP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.67 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|