C17H13ClNO3- — CID 2393598
(3R)-2-(2-chlorobenzoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 2393598) has the molecular formula C17H13ClNO3- and a molecular weight of 314.75 g/mol. Its IUPAC name is (3R)-2-(2-chlorobenzoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate.
| Compound Name | (3R)-2-(2-chlorobenzoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 2393598 |
| Molecular Formula | C17H13ClNO3- |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (3R)-2-(2-chlorobenzoyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | O=C([O-])[C@H]1Cc2ccccc2CN1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H14ClNO3/c18-14-8-4-3-7-13(14)16(20)19-10-12-6-2-1-5-11(12)9-15(19)17(21)22/h1-8,15H,9-10H2,(H,21,22)/p-1/t15-/m1/s1 |
| InChIKey | BBVPTOVGZUPXIX-OAHLLOKOSA-M |
| XLogP | 1.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |