C18H15NO2 — CID 62230372
1,3-dihydroisoindol-2-yl-[2-(3-hydroxyprop-1-ynyl)phenyl]methanone (PubChem CID 62230372) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 1,3-dihydroisoindol-2-yl-[2-(3-hydroxyprop-1-ynyl)phenyl]methanone.
| Compound Name | 1,3-dihydroisoindol-2-yl-[2-(3-hydroxyprop-1-ynyl)phenyl]methanone |
|---|---|
| PubChem CID | 62230372 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1,3-dihydroisoindol-2-yl-[2-(3-hydroxyprop-1-ynyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1C#CCO)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C18H15NO2/c20-11-5-9-14-6-3-4-10-17(14)18(21)19-12-15-7-1-2-8-16(15)13-19/h1-4,6-8,10,20H,11-13H2 |
| InChIKey | XRMJTEGVQFZSRN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|