C17H14N2O2 — CID 62230536
1,3-dihydroisoindol-2-yl-[5-(3-hydroxyprop-1-ynyl)-3-pyridinyl]methanone (PubChem CID 62230536) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 1,3-dihydroisoindol-2-yl-[5-(3-hydroxyprop-1-ynyl)-3-pyridinyl]methanone.
| Compound Name | 1,3-dihydroisoindol-2-yl-[5-(3-hydroxyprop-1-ynyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 62230536 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1,3-dihydroisoindol-2-yl-[5-(3-hydroxyprop-1-ynyl)-3-pyridinyl]methanone |
| SMILES | O=C(c1cncc(C#CCO)c1)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H14N2O2/c20-7-3-4-13-8-16(10-18-9-13)17(21)19-11-14-5-1-2-6-15(14)12-19/h1-2,5-6,8-10,20H,7,11-12H2 |
| InChIKey | PSQNBKLDFUXDJT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|