C12H17ClN3O+ — CID 2353198
(2-chloro-3-pyridinyl)-(4-methyl-1,4-diazepan-4-ium-1-yl)methanone (PubChem CID 2353198) has the molecular formula C12H17ClN3O+ and a molecular weight of 254.74 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl)-(4-methyl-1,4-diazepan-4-ium-1-yl)methanone.
| Compound Name | (2-chloro-3-pyridinyl)-(4-methyl-1,4-diazepan-4-ium-1-yl)methanone |
|---|---|
| PubChem CID | 2353198 |
| Molecular Formula | C12H17ClN3O+ |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (2-chloro-3-pyridinyl)-(4-methyl-1,4-diazepan-4-ium-1-yl)methanone |
| SMILES | C[NH+]1CCCN(C(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C12H16ClN3O/c1-15-6-3-7-16(9-8-15)12(17)10-4-2-5-14-11(10)13/h2,4-5H,3,6-9H2,1H3/p+1 |
| InChIKey | FBDCRVUARSZBNE-UHFFFAOYSA-O |
| XLogP | 0.10 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|