C12H14ClN3O2 — CID 102848032
4-(2-chloropyridine-3-carbonyl)-1-methyl-1,4-diazepan-2-one (PubChem CID 102848032) has the molecular formula C12H14ClN3O2 and a molecular weight of 267.72 g/mol. Its IUPAC name is 4-(2-chloropyridine-3-carbonyl)-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(2-chloropyridine-3-carbonyl)-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102848032 |
| Molecular Formula | C12H14ClN3O2 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 4-(2-chloropyridine-3-carbonyl)-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(C(=O)c2cccnc2Cl)CC1=O |
| InChI | InChI=1S/C12H14ClN3O2/c1-15-6-3-7-16(8-10(15)17)12(18)9-4-2-5-14-11(9)13/h2,4-5H,3,6-8H2,1H3 |
| InChIKey | OTJWPKNBRYEWRT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|