C12H16N4O2 — CID 102892425
4-(4-aminopyridine-2-carbonyl)-1-methyl-1,4-diazepan-2-one (PubChem CID 102892425) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 4-(4-aminopyridine-2-carbonyl)-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(4-aminopyridine-2-carbonyl)-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102892425 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4-(4-aminopyridine-2-carbonyl)-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(C(=O)c2cc(N)ccn2)CC1=O |
| InChI | InChI=1S/C12H16N4O2/c1-15-5-2-6-16(8-11(15)17)12(18)10-7-9(13)3-4-14-10/h3-4,7H,2,5-6,8H2,1H3,(H2,13,14) |
| InChIKey | KZMCKHKXXLBGBG-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |