C15H17N3O3 — CID 102888084
4-(5-amino-1-benzofuran-2-carbonyl)-1-methyl-1,4-diazepan-2-one (PubChem CID 102888084) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-(5-amino-1-benzofuran-2-carbonyl)-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(5-amino-1-benzofuran-2-carbonyl)-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102888084 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 4-(5-amino-1-benzofuran-2-carbonyl)-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(C(=O)c2cc3cc(N)ccc3o2)CC1=O |
| InChI | InChI=1S/C15H17N3O3/c1-17-5-2-6-18(9-14(17)19)15(20)13-8-10-7-11(16)3-4-12(10)21-13/h3-4,7-8H,2,5-6,9,16H2,1H3 |
| InChIKey | UNWZTYQAWCAEOK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|