C12H18N4O3S2 — CID 32505607
N,N-dimethyl-4-(2-sulfanylidene-1H-pyridine-3-carbonyl)piperazine-1-sulfonamide (PubChem CID 32505607) has the molecular formula C12H18N4O3S2 and a molecular weight of 330.44 g/mol. Its IUPAC name is N,N-dimethyl-4-(2-sulfanylidene-1H-pyridine-3-carbonyl)piperazine-1-sulfonamide.
| Compound Name | N,N-dimethyl-4-(2-sulfanylidene-1H-pyridine-3-carbonyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 32505607 |
| Molecular Formula | C12H18N4O3S2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N,N-dimethyl-4-(2-sulfanylidene-1H-pyridine-3-carbonyl)piperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(C(=O)c2ccc[nH]c2=S)CC1 |
| InChI | InChI=1S/C12H18N4O3S2/c1-14(2)21(18,19)16-8-6-15(7-9-16)12(17)10-4-3-5-13-11(10)20/h3-5H,6-9H2,1-2H3,(H,13,20) |
| InChIKey | ZWOGXMQBPILUDI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|