C19H17ClINO3 — CID 112823992
(5-chloro-4-iodo-2-methoxyphenyl)-[4-(4-hydroxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 112823992) has the molecular formula C19H17ClINO3 and a molecular weight of 469.71 g/mol. Its IUPAC name is (5-chloro-4-iodo-2-methoxyphenyl)-[4-(4-hydroxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | (5-chloro-4-iodo-2-methoxyphenyl)-[4-(4-hydroxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 112823992 |
| Molecular Formula | C19H17ClINO3 |
| Molecular Weight | 469.71 g/mol |
| Exact Mass | 468.99 |
| IUPAC Name | (5-chloro-4-iodo-2-methoxyphenyl)-[4-(4-hydroxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | COc1cc(I)c(Cl)cc1C(=O)N1CC=C(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C19H17ClINO3/c1-25-18-11-17(21)16(20)10-15(18)19(24)22-8-6-13(7-9-22)12-2-4-14(23)5-3-12/h2-6,10-11,23H,7-9H2,1H3 |
| InChIKey | FMDPTLUQLLOBDZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.71 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|