C18H15BrINO2 — CID 112802745
(5-bromo-2-iodophenyl)-[4-(4-hydroxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 112802745) has the molecular formula C18H15BrINO2 and a molecular weight of 484.13 g/mol. Its IUPAC name is (5-bromo-2-iodophenyl)-[4-(4-hydroxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | (5-bromo-2-iodophenyl)-[4-(4-hydroxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 112802745 |
| Molecular Formula | C18H15BrINO2 |
| Molecular Weight | 484.13 g/mol |
| Exact Mass | 482.93 |
| IUPAC Name | (5-bromo-2-iodophenyl)-[4-(4-hydroxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | O=C(c1cc(Br)ccc1I)N1CC=C(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C18H15BrINO2/c19-14-3-6-17(20)16(11-14)18(23)21-9-7-13(8-10-21)12-1-4-15(22)5-2-12/h1-7,11,22H,8-10H2 |
| InChIKey | IPJXVDLZHJBRSJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.13 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|