C12H15NO3 — CID 10560934
[(3R)-3-hydroxypyrrolidin-1-yl]-(2-methoxyphenyl)methanone (PubChem CID 10560934) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is [(3R)-3-hydroxypyrrolidin-1-yl]-(2-methoxyphenyl)methanone.
| Compound Name | [(3R)-3-hydroxypyrrolidin-1-yl]-(2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 10560934 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | [(3R)-3-hydroxypyrrolidin-1-yl]-(2-methoxyphenyl)methanone |
| SMILES | COc1ccccc1C(=O)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C12H15NO3/c1-16-11-5-3-2-4-10(11)12(15)13-7-6-9(14)8-13/h2-5,9,14H,6-8H2,1H3/t9-/m1/s1 |
| InChIKey | GTVXKCZVWAIBGY-SECBINFHSA-N |
| XLogP | 0.90 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |