C12H13F2NO3 — CID 79029867
[2-(difluoromethoxy)phenyl]-[(3R)-3-hydroxypyrrolidin-1-yl]methanone (PubChem CID 79029867) has the molecular formula C12H13F2NO3 and a molecular weight of 257.24 g/mol. Its IUPAC name is [2-(difluoromethoxy)phenyl]-[(3R)-3-hydroxypyrrolidin-1-yl]methanone.
| Compound Name | [2-(difluoromethoxy)phenyl]-[(3R)-3-hydroxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 79029867 |
| Molecular Formula | C12H13F2NO3 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | [2-(difluoromethoxy)phenyl]-[(3R)-3-hydroxypyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1OC(F)F)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C12H13F2NO3/c13-12(14)18-10-4-2-1-3-9(10)11(17)15-6-5-8(16)7-15/h1-4,8,12,16H,5-7H2/t8-/m1/s1 |
| InChIKey | OWKGLKDSWYIRKT-MRVPVSSYSA-N |
| XLogP | 1.49 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |