C18H23F2N3O3 — CID 119409468
[(3R)-3-aminopyrrolidin-1-yl]-[1-[2-(difluoromethoxy)benzoyl]piperidin-3-yl]methanone (PubChem CID 119409468) has the molecular formula C18H23F2N3O3 and a molecular weight of 367.40 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-[1-[2-(difluoromethoxy)benzoyl]piperidin-3-yl]methanone.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-[1-[2-(difluoromethoxy)benzoyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 119409468 |
| Molecular Formula | C18H23F2N3O3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-[1-[2-(difluoromethoxy)benzoyl]piperidin-3-yl]methanone |
| SMILES | N[C@@H]1CCN(C(=O)C2CCCN(C(=O)c3ccccc3OC(F)F)C2)C1 |
| InChI | InChI=1S/C18H23F2N3O3/c19-18(20)26-15-6-2-1-5-14(15)17(25)22-8-3-4-12(10-22)16(24)23-9-7-13(21)11-23/h1-2,5-6,12-13,18H,3-4,7-11,21H2/t12?,13-/m1/s1 |
| InChIKey | AQAJGTIQLJFNAP-ZGTCLIOFSA-N |
| XLogP | 1.70 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |