C17H23F2N3O3 — CID 119405060
N-(3-aminopropyl)-1-[2-(difluoromethoxy)benzoyl]piperidine-3-carboxamide (PubChem CID 119405060) has the molecular formula C17H23F2N3O3 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-(3-aminopropyl)-1-[2-(difluoromethoxy)benzoyl]piperidine-3-carboxamide.
| Compound Name | N-(3-aminopropyl)-1-[2-(difluoromethoxy)benzoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119405060 |
| Molecular Formula | C17H23F2N3O3 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | N-(3-aminopropyl)-1-[2-(difluoromethoxy)benzoyl]piperidine-3-carboxamide |
| SMILES | NCCCNC(=O)C1CCCN(C(=O)c2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C17H23F2N3O3/c18-17(19)25-14-7-2-1-6-13(14)16(24)22-10-3-5-12(11-22)15(23)21-9-4-8-20/h1-2,6-7,12,17H,3-5,8-11,20H2,(H,21,23) |
| InChIKey | HKQPFLKIXMAWSM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|