C15H18F2N2O4 — CID 46416186
1-[2-(difluoromethoxy)benzoyl]-N-methoxypiperidine-3-carboxamide (PubChem CID 46416186) has the molecular formula C15H18F2N2O4 and a molecular weight of 328.31 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)benzoyl]-N-methoxypiperidine-3-carboxamide.
| Compound Name | 1-[2-(difluoromethoxy)benzoyl]-N-methoxypiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46416186 |
| Molecular Formula | C15H18F2N2O4 |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1-[2-(difluoromethoxy)benzoyl]-N-methoxypiperidine-3-carboxamide |
| SMILES | CONC(=O)C1CCCN(C(=O)c2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C15H18F2N2O4/c1-22-18-13(20)10-5-4-8-19(9-10)14(21)11-6-2-3-7-12(11)23-15(16)17/h2-3,6-7,10,15H,4-5,8-9H2,1H3,(H,18,20) |
| InChIKey | JOZGIQOQJDZGPL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|