C24H33F2N3O3 — CID 56568849
1-[2-(difluoromethoxy)benzoyl]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]piperidine-3-carboxamide (PubChem CID 56568849) has the molecular formula C24H33F2N3O3 and a molecular weight of 449.54 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)benzoyl]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]piperidine-3-carboxamide.
| Compound Name | 1-[2-(difluoromethoxy)benzoyl]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56568849 |
| Molecular Formula | C24H33F2N3O3 |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 1-[2-(difluoromethoxy)benzoyl]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]piperidine-3-carboxamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)C2CCCN(C(=O)c3ccccc3OC(F)F)C2)CC1 |
| InChI | InChI=1S/C24H33F2N3O3/c1-17(2)9-13-28-14-10-19(11-15-28)27-22(30)18-6-5-12-29(16-18)23(31)20-7-3-4-8-21(20)32-24(25)26/h3-4,7-9,18-19,24H,5-6,10-16H2,1-2H3,(H,27,30) |
| InChIKey | BHLJHWWTHXAAGF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|