C22H25F2N5O3 — CID 55637957
[1-[2-(difluoromethoxy)benzoyl]piperidin-3-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 55637957) has the molecular formula C22H25F2N5O3 and a molecular weight of 445.47 g/mol. Its IUPAC name is [1-[2-(difluoromethoxy)benzoyl]piperidin-3-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [1-[2-(difluoromethoxy)benzoyl]piperidin-3-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 55637957 |
| Molecular Formula | C22H25F2N5O3 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | [1-[2-(difluoromethoxy)benzoyl]piperidin-3-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccccc1OC(F)F)N1CCCC(C(=O)N2CCN(c3ncccn3)CC2)C1 |
| InChI | InChI=1S/C22H25F2N5O3/c23-21(24)32-18-7-2-1-6-17(18)20(31)29-10-3-5-16(15-29)19(30)27-11-13-28(14-12-27)22-25-8-4-9-26-22/h1-2,4,6-9,16,21H,3,5,10-15H2 |
| InChIKey | BKVALMPTMFRDTI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |