C17H24F2N2O2 — CID 97141421
[2-(difluoromethoxy)phenyl]-[4-[(1R)-1-(dimethylamino)ethyl]piperidin-1-yl]methanone (PubChem CID 97141421) has the molecular formula C17H24F2N2O2 and a molecular weight of 326.39 g/mol. Its IUPAC name is [2-(difluoromethoxy)phenyl]-[4-[(1R)-1-(dimethylamino)ethyl]piperidin-1-yl]methanone.
| Compound Name | [2-(difluoromethoxy)phenyl]-[4-[(1R)-1-(dimethylamino)ethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 97141421 |
| Molecular Formula | C17H24F2N2O2 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | [2-(difluoromethoxy)phenyl]-[4-[(1R)-1-(dimethylamino)ethyl]piperidin-1-yl]methanone |
| SMILES | C[C@H](C1CCN(C(=O)c2ccccc2OC(F)F)CC1)N(C)C |
| InChI | InChI=1S/C17H24F2N2O2/c1-12(20(2)3)13-8-10-21(11-9-13)16(22)14-6-4-5-7-15(14)23-17(18)19/h4-7,12-13,17H,8-11H2,1-3H3/t12-/m1/s1 |
| InChIKey | XBFKUCSRPYPTDH-GFCCVEGCSA-N |
| XLogP | 3.09 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |