C20H26F2N2O3 — CID 134001998
2-cyclohexyl-1-[4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]ethanone (PubChem CID 134001998) has the molecular formula C20H26F2N2O3 and a molecular weight of 380.44 g/mol. Its IUPAC name is 2-cyclohexyl-1-[4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]ethanone.
| Compound Name | 2-cyclohexyl-1-[4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 134001998 |
| Molecular Formula | C20H26F2N2O3 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 2-cyclohexyl-1-[4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]ethanone |
| SMILES | O=C(CC1CCCCC1)N1CCN(C(=O)c2ccccc2OC(F)F)CC1 |
| InChI | InChI=1S/C20H26F2N2O3/c21-20(22)27-17-9-5-4-8-16(17)19(26)24-12-10-23(11-13-24)18(25)14-15-6-2-1-3-7-15/h4-5,8-9,15,20H,1-3,6-7,10-14H2 |
| InChIKey | KHILZJVIGOSKIX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |