C18H25F2N3O4S — CID 34343631
[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-[2-(difluoromethoxy)phenyl]methanone (PubChem CID 34343631) has the molecular formula C18H25F2N3O4S and a molecular weight of 417.48 g/mol. Its IUPAC name is [4-(azepan-1-ylsulfonyl)piperazin-1-yl]-[2-(difluoromethoxy)phenyl]methanone.
| Compound Name | [4-(azepan-1-ylsulfonyl)piperazin-1-yl]-[2-(difluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 34343631 |
| Molecular Formula | C18H25F2N3O4S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | [4-(azepan-1-ylsulfonyl)piperazin-1-yl]-[2-(difluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1ccccc1OC(F)F)N1CCN(S(=O)(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C18H25F2N3O4S/c19-18(20)27-16-8-4-3-7-15(16)17(24)21-11-13-23(14-12-21)28(25,26)22-9-5-1-2-6-10-22/h3-4,7-8,18H,1-2,5-6,9-14H2 |
| InChIKey | MMLRSCGIOKGONQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |