C20H27F2N3O4S — CID 24669754
(E)-1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-3-[2-(difluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 24669754) has the molecular formula C20H27F2N3O4S and a molecular weight of 443.52 g/mol. Its IUPAC name is (E)-1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-3-[2-(difluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-3-[2-(difluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 24669754 |
| Molecular Formula | C20H27F2N3O4S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | (E)-1-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-3-[2-(difluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1OC(F)F)N1CCN(S(=O)(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C20H27F2N3O4S/c21-20(22)29-18-8-4-3-7-17(18)9-10-19(26)23-13-15-25(16-14-23)30(27,28)24-11-5-1-2-6-12-24/h3-4,7-10,20H,1-2,5-6,11-16H2/b10-9+ |
| InChIKey | GFFRHBQXPDCPKP-MDZDMXLPSA-N |
| XLogP | 2.57 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|