C18H21F2NO4 — CID 55527912
ethyl 1-[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]piperidine-3-carboxylate (PubChem CID 55527912) has the molecular formula C18H21F2NO4 and a molecular weight of 353.37 g/mol. Its IUPAC name is ethyl 1-[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55527912 |
| Molecular Formula | C18H21F2NO4 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | ethyl 1-[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)/C=C/c2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C18H21F2NO4/c1-2-24-17(23)14-7-5-11-21(12-14)16(22)10-9-13-6-3-4-8-15(13)25-18(19)20/h3-4,6,8-10,14,18H,2,5,7,11-12H2,1H3/b10-9+ |
| InChIKey | VGGPMLHLALAQJX-MDZDMXLPSA-N |
| XLogP | 3.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|