C16H19F2N3O3 — CID 72684452
4-[3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]-1,4-diazepane-1-carboxamide (PubChem CID 72684452) has the molecular formula C16H19F2N3O3 and a molecular weight of 339.34 g/mol. Its IUPAC name is 4-[3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 72684452 |
| Molecular Formula | C16H19F2N3O3 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 4-[3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]-1,4-diazepane-1-carboxamide |
| SMILES | NC(=O)N1CCCN(C(=O)C=Cc2ccccc2OC(F)F)CC1 |
| InChI | InChI=1S/C16H19F2N3O3/c17-15(18)24-13-5-2-1-4-12(13)6-7-14(22)20-8-3-9-21(11-10-20)16(19)23/h1-2,4-7,15H,3,8-11H2,(H2,19,23) |
| InChIKey | IRCKJKLTZLVCAQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|