C20H27F2N3O5S — CID 55619626
(E)-3-[2-(difluoromethoxy)phenyl]-1-[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 55619626) has the molecular formula C20H27F2N3O5S and a molecular weight of 459.52 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-1-[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-1-[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55619626 |
| Molecular Formula | C20H27F2N3O5S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-1-[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | CC1CN(S(=O)(=O)N2CCN(C(=O)/C=C/c3ccccc3OC(F)F)CC2)CC(C)O1 |
| InChI | InChI=1S/C20H27F2N3O5S/c1-15-13-25(14-16(2)29-15)31(27,28)24-11-9-23(10-12-24)19(26)8-7-17-5-3-4-6-18(17)30-20(21)22/h3-8,15-16,20H,9-14H2,1-2H3/b8-7+ |
| InChIKey | ITVQOEUCRUGEPK-BQYQJAHWSA-N |
| XLogP | 1.80 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|