C22H20F2N2O3 — CID 97433134
(Z)-1-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-3-[2-(difluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 97433134) has the molecular formula C22H20F2N2O3 and a molecular weight of 398.41 g/mol. Its IUPAC name is (Z)-1-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-3-[2-(difluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (Z)-1-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-3-[2-(difluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 97433134 |
| Molecular Formula | C22H20F2N2O3 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (Z)-1-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-3-[2-(difluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C\c1ccccc1OC(F)F)N1CCC(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C22H20F2N2O3/c23-22(24)29-18-7-3-1-5-15(18)9-10-20(27)26-13-11-16(12-14-26)21-25-17-6-2-4-8-19(17)28-21/h1-10,16,22H,11-14H2/b10-9- |
| InChIKey | JZBKVNXSNYTGLE-KTKRTIGZSA-N |
| XLogP | 4.85 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|