C22H18ClF3N2O2 — CID 55330104
(E)-1-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 55330104) has the molecular formula C22H18ClF3N2O2 and a molecular weight of 434.85 g/mol. Its IUPAC name is (E)-1-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55330104 |
| Molecular Formula | C22H18ClF3N2O2 |
| Molecular Weight | 434.85 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | (E)-1-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-3-[2-chloro-5-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(C(F)(F)F)ccc1Cl)N1CCC(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C22H18ClF3N2O2/c23-17-7-6-16(22(24,25)26)13-15(17)5-8-20(29)28-11-9-14(10-12-28)21-27-18-3-1-2-4-19(18)30-21/h1-8,13-14H,9-12H2/b8-5+ |
| InChIKey | QHYQIZGEXOBIJF-VMPITWQZSA-N |
| XLogP | 5.92 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.85 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|